Environmental Chemistry
Homework Assignment 7 (28 points)
- Consider the following compound:
Which of the following characteristics is not possessed by the compound: (a) one end of the molecule is hydrophilic and the other end is hydrophobic, (b) surface active qualities, (c) the ability to lower surface tension of water, (d) good biodegradability, (e) tendency to cause foam in sewage treatment plants.
2. A certain pesticide is fatal to fish fingerlings at a level of 0.50 parts per million in water. A leaking metal can containing 5.00 kg of the pesticide was dumped into a stream with a flow of 10.0 liters per second moving at 1 kilometer per hour. The container leaks pesticide at a constant rate of 5 mg/sec. For what distance (in km) downstream is the water contaminated by fatal levels of the pesticide by the time the container is empty?
3. Discuss the chemical reactivity of alkanes. Why are they chemically reactive or unreactive?
4. Discuss the chemical reactivity of alkenes. Why are they chemically reactive or unreactive?
5. What are the characteristics of aromaticity? What are the chemical reactivity characteristics of aromatic compounds?
6. Give the structural formula corresponding to the condensed structural formula of CH3CH(C2H5)CH(C2H5)CH2CH3.
7. Draw the structural formula for one example molecule of each of the following: an alcohol, a ketone, an alkene, an aldehyde, a carboxylic acid, an aromatic compound.
ENV 440 Homework